C28H26O6 — CID 159584072
(2S,3R,4S,5S,6R)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol;pentaphene (PubChem CID 159584072) has the molecular formula C28H26O6 and a molecular weight of 458.51 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol;pentaphene.
| Compound Name | (2S,3R,4S,5S,6R)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol;pentaphene |
|---|---|
| PubChem CID | 159584072 |
| Molecular Formula | C28H26O6 |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | (2S,3R,4S,5S,6R)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol;pentaphene |
| SMILES | OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1O.c1ccc2cc3c(ccc4cc5ccccc5cc43)cc2c1 |
| InChI | InChI=1S/C22H14.C6H12O6/c1-3-7-17-13-21-19(11-15(17)5-1)9-10-20-12-16-6-2-4-8-18(16)14-22(20)21;7-1-2-3(8)4(9)5(10)6(11)12-2/h1-14H;2-11H,1H2/t;2-,3-,4+,5-,6+/m.1/s1 |
| InChIKey | MJJSHXGJQKCNSS-OXBJBCBCSA-N |
| XLogP | 3.08 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|