C18H22O6 — CID 158276148
1,1'-biphenyl;(3R,4S,5S,6R)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol (PubChem CID 158276148) has the molecular formula C18H22O6 and a molecular weight of 334.37 g/mol. Its IUPAC name is 1,1'-biphenyl;(3R,4S,5S,6R)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol.
| Compound Name | 1,1'-biphenyl;(3R,4S,5S,6R)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 158276148 |
| Molecular Formula | C18H22O6 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 1,1'-biphenyl;(3R,4S,5S,6R)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol |
| SMILES | OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.C6H12O6/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;7-1-2-3(8)4(9)5(10)6(11)12-2/h1-10H;2-11H,1H2/t;2-,3-,4+,5-,6?/m.1/s1 |
| InChIKey | GJQAEEXUSYJTSR-MSPHXDAXSA-N |
| XLogP | 0.13 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |