C20H20O6 — CID 87681257
(2R,3R,4S,5R,6R)-3-anthracen-1-yloxy-6-(hydroxymethyl)oxane-2,4,5-triol (PubChem CID 87681257) has the molecular formula C20H20O6 and a molecular weight of 356.37 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-3-anthracen-1-yloxy-6-(hydroxymethyl)oxane-2,4,5-triol.
| Compound Name | (2R,3R,4S,5R,6R)-3-anthracen-1-yloxy-6-(hydroxymethyl)oxane-2,4,5-triol |
|---|---|
| PubChem CID | 87681257 |
| Molecular Formula | C20H20O6 |
| Molecular Weight | 356.37 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | (2R,3R,4S,5R,6R)-3-anthracen-1-yloxy-6-(hydroxymethyl)oxane-2,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](O)[C@H](Oc2cccc3cc4ccccc4cc23)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C20H20O6/c21-10-16-17(22)18(23)19(20(24)26-16)25-15-7-3-6-13-8-11-4-1-2-5-12(11)9-14(13)15/h1-9,16-24H,10H2/t16-,17+,18+,19-,20-/m1/s1 |
| InChIKey | BVPSYXHYNQWBPI-LCWAXJCOSA-N |
| XLogP | 1.17 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.37 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|