C33H26O5 — CID 91407822
(2R,3S,4S,5R)-2,5-di(anthracen-1-yloxy)oxane-3,4-diol (PubChem CID 91407822) has the molecular formula C33H26O5 and a molecular weight of 502.57 g/mol. Its IUPAC name is (2R,3S,4S,5R)-2,5-di(anthracen-1-yloxy)oxane-3,4-diol.
| Compound Name | (2R,3S,4S,5R)-2,5-di(anthracen-1-yloxy)oxane-3,4-diol |
|---|---|
| PubChem CID | 91407822 |
| Molecular Formula | C33H26O5 |
| Molecular Weight | 502.57 g/mol |
| Exact Mass | 502.18 |
| IUPAC Name | (2R,3S,4S,5R)-2,5-di(anthracen-1-yloxy)oxane-3,4-diol |
| SMILES | O[C@@H]1[C@@H](Oc2cccc3cc4ccccc4cc23)OC[C@@H](Oc2cccc3cc4ccccc4cc23)[C@H]1O |
| InChI | InChI=1S/C33H26O5/c34-31-30(37-28-13-5-11-24-15-20-7-1-3-9-22(20)17-26(24)28)19-36-33(32(31)35)38-29-14-6-12-25-16-21-8-2-4-10-23(21)18-27(25)29/h1-18,30-35H,19H2/t30-,31-,32+,33-/m1/s1 |
| InChIKey | NSLKXNQYUWJEFR-NXVJRICRSA-N |
| XLogP | 6.20 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.57 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|