C15H16O6 — CID 11173848
(2S,3R,4S,5R)-2-(3-hydroxynaphthalen-2-yl)oxyoxane-3,4,5-triol (PubChem CID 11173848) has the molecular formula C15H16O6 and a molecular weight of 292.29 g/mol. Its IUPAC name is (2S,3R,4S,5R)-2-(3-hydroxynaphthalen-2-yl)oxyoxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5R)-2-(3-hydroxynaphthalen-2-yl)oxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 11173848 |
| Molecular Formula | C15H16O6 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | (2S,3R,4S,5R)-2-(3-hydroxynaphthalen-2-yl)oxyoxane-3,4,5-triol |
| SMILES | Oc1cc2ccccc2cc1O[C@@H]1OC[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C15H16O6/c16-10-5-8-3-1-2-4-9(8)6-12(10)21-15-14(19)13(18)11(17)7-20-15/h1-6,11,13-19H,7H2/t11-,13+,14-,15+/m1/s1 |
| InChIKey | IUVYMKZXVHADTI-BEAPCOKYSA-N |
| XLogP | 0.36 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |