C15H15FO5 — CID 164817617
(2S,4S,5R)-2-(4-(18F)fluoronaphthalen-1-yl)oxyoxane-3,4,5-triol (PubChem CID 164817617) has the molecular formula C15H15FO5 and a molecular weight of 293.28 g/mol. Its IUPAC name is (2S,4S,5R)-2-(4-(18F)fluoronaphthalen-1-yl)oxyoxane-3,4,5-triol.
| Compound Name | (2S,4S,5R)-2-(4-(18F)fluoronaphthalen-1-yl)oxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 164817617 |
| Molecular Formula | C15H15FO5 |
| Molecular Weight | 293.28 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | (2S,4S,5R)-2-(4-(18F)fluoronaphthalen-1-yl)oxyoxane-3,4,5-triol |
| SMILES | OC1[C@H](Oc2ccc([18F])c3ccccc23)OC[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H15FO5/c16-10-5-6-12(9-4-2-1-3-8(9)10)21-15-14(19)13(18)11(17)7-20-15/h1-6,11,13-15,17-19H,7H2/t11-,13+,14?,15+/m1/s1/i16-1 |
| InChIKey | YGZQJUBPTLKEHQ-ZXIGKTNMSA-N |
| XLogP | 0.80 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.28 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |