C16H16O8 — CID 146116161
1-hydroxy-4-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxynaphthalene-2-carboxylic acid (PubChem CID 146116161) has the molecular formula C16H16O8 and a molecular weight of 336.30 g/mol. Its IUPAC name is 1-hydroxy-4-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxynaphthalene-2-carboxylic acid.
| Compound Name | 1-hydroxy-4-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxynaphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 146116161 |
| Molecular Formula | C16H16O8 |
| Molecular Weight | 336.30 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 1-hydroxy-4-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxynaphthalene-2-carboxylic acid |
| SMILES | O=C(O)c1cc(O[C@@H]2OC[C@@H](O)[C@H](O)[C@H]2O)c2ccccc2c1O |
| InChI | InChI=1S/C16H16O8/c17-10-6-23-16(14(20)13(10)19)24-11-5-9(15(21)22)12(18)8-4-2-1-3-7(8)11/h1-5,10,13-14,16-20H,6H2,(H,21,22)/t10-,13+,14-,16+/m1/s1 |
| InChIKey | GHXYYEIFZJTLLF-FTOGJNOLSA-N |
| XLogP | 0.06 |
| TPSA | 136.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.30 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |