C20H18O5 — CID 54339362
1-hydroxy-4-[2-(4-methylphenoxy)ethoxy]naphthalene-2-carboxylic acid (PubChem CID 54339362) has the molecular formula C20H18O5 and a molecular weight of 338.36 g/mol. Its IUPAC name is 1-hydroxy-4-[2-(4-methylphenoxy)ethoxy]naphthalene-2-carboxylic acid.
| Compound Name | 1-hydroxy-4-[2-(4-methylphenoxy)ethoxy]naphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 54339362 |
| Molecular Formula | C20H18O5 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 1-hydroxy-4-[2-(4-methylphenoxy)ethoxy]naphthalene-2-carboxylic acid |
| SMILES | Cc1ccc(OCCOc2cc(C(=O)O)c(O)c3ccccc23)cc1 |
| InChI | InChI=1S/C20H18O5/c1-13-6-8-14(9-7-13)24-10-11-25-18-12-17(20(22)23)19(21)16-5-3-2-4-15(16)18/h2-9,12,21H,10-11H2,1H3,(H,22,23) |
| InChIKey | TXVHJXGWECUMNH-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|