C18H14N2O3 — CID 136679288
1-hydroxy-4-[(4-methylphenyl)diazenyl]naphthalene-2-carboxylic acid (PubChem CID 136679288) has the molecular formula C18H14N2O3 and a molecular weight of 306.32 g/mol. Its IUPAC name is 1-hydroxy-4-[(4-methylphenyl)diazenyl]naphthalene-2-carboxylic acid.
| Compound Name | 1-hydroxy-4-[(4-methylphenyl)diazenyl]naphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 136679288 |
| Molecular Formula | C18H14N2O3 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 1-hydroxy-4-[(4-methylphenyl)diazenyl]naphthalene-2-carboxylic acid |
| SMILES | Cc1ccc(/N=N/c2cc(C(=O)O)c(O)c3ccccc23)cc1 |
| InChI | InChI=1S/C18H14N2O3/c1-11-6-8-12(9-7-11)19-20-16-10-15(18(22)23)17(21)14-5-3-2-4-13(14)16/h2-10,21H,1H3,(H,22,23)/b20-19+ |
| InChIKey | ULLGOQWKCNOPNQ-FMQUCBEESA-N |
| XLogP | 4.97 |
| TPSA | 82.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|