C16H12N2O2 — CID 135400911
2-phenyldiazenylnaphthalene-1,4-diol (PubChem CID 135400911) has the molecular formula C16H12N2O2 and a molecular weight of 264.28 g/mol. Its IUPAC name is 2-phenyldiazenylnaphthalene-1,4-diol.
| Compound Name | 2-phenyldiazenylnaphthalene-1,4-diol |
|---|---|
| PubChem CID | 135400911 |
| Molecular Formula | C16H12N2O2 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 2-phenyldiazenylnaphthalene-1,4-diol |
| SMILES | Oc1cc(/N=N/c2ccccc2)c(O)c2ccccc12 |
| InChI | InChI=1S/C16H12N2O2/c19-15-10-14(18-17-11-6-2-1-3-7-11)16(20)13-9-5-4-8-12(13)15/h1-10,19-20H/b18-17+ |
| InChIKey | NYKBVQAMYKSHLA-ISLYRVAYSA-N |
| XLogP | 4.67 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|