C13H13NO2 — CID 123930537
2-(propylideneamino)naphthalene-1,4-diol (PubChem CID 123930537) has the molecular formula C13H13NO2 and a molecular weight of 215.25 g/mol. Its IUPAC name is 2-(propylideneamino)naphthalene-1,4-diol.
| Compound Name | 2-(propylideneamino)naphthalene-1,4-diol |
|---|---|
| PubChem CID | 123930537 |
| Molecular Formula | C13H13NO2 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | 2-(propylideneamino)naphthalene-1,4-diol |
| SMILES | CC/C=N/c1cc(O)c2ccccc2c1O |
| InChI | InChI=1S/C13H13NO2/c1-2-7-14-11-8-12(15)9-5-3-4-6-10(9)13(11)16/h3-8,15-16H,2H2,1H3/b14-7+ |
| InChIKey | WPKOQPWUMZXGLO-VGOFMYFVSA-N |
| XLogP | 3.36 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|