C16H21O2P — CID 141045997
2-dipropylphosphanylnaphthalene-1,4-diol (PubChem CID 141045997) has the molecular formula C16H21O2P and a molecular weight of 276.32 g/mol. Its IUPAC name is 2-dipropylphosphanylnaphthalene-1,4-diol.
| Compound Name | 2-dipropylphosphanylnaphthalene-1,4-diol |
|---|---|
| PubChem CID | 141045997 |
| Molecular Formula | C16H21O2P |
| Molecular Weight | 276.32 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 2-dipropylphosphanylnaphthalene-1,4-diol |
| SMILES | CCCP(CCC)c1cc(O)c2ccccc2c1O |
| InChI | InChI=1S/C16H21O2P/c1-3-9-19(10-4-2)15-11-14(17)12-7-5-6-8-13(12)16(15)18/h5-8,11,17-18H,3-4,9-10H2,1-2H3 |
| InChIKey | PNXNUILKDSULIJ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.32 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|