C28H22O2P+ — CID 2783475
(1,4-dihydroxynaphthalen-2-yl)-triphenylphosphanium (PubChem CID 2783475) has the molecular formula C28H22O2P+ and a molecular weight of 421.46 g/mol. Its IUPAC name is (1,4-dihydroxynaphthalen-2-yl)-triphenylphosphanium.
| Compound Name | (1,4-dihydroxynaphthalen-2-yl)-triphenylphosphanium |
|---|---|
| PubChem CID | 2783475 |
| Molecular Formula | C28H22O2P+ |
| Molecular Weight | 421.46 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | (1,4-dihydroxynaphthalen-2-yl)-triphenylphosphanium |
| SMILES | Oc1cc([P+](c2ccccc2)(c2ccccc2)c2ccccc2)c(O)c2ccccc12 |
| InChI | InChI=1S/C28H21O2P/c29-26-20-27(28(30)25-19-11-10-18-24(25)26)31(21-12-4-1-5-13-21,22-14-6-2-7-15-22)23-16-8-3-9-17-23/h1-20H,(H-,29,30)/p+1 |
| InChIKey | SEEQKBNCPWCWCP-UHFFFAOYSA-O |
| XLogP | 4.87 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.46 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|