C17H12O3 — CID 11277063
(1,4-dihydroxynaphthalen-2-yl)-phenylmethanone (PubChem CID 11277063) has the molecular formula C17H12O3 and a molecular weight of 264.28 g/mol. Its IUPAC name is (1,4-dihydroxynaphthalen-2-yl)-phenylmethanone.
| Compound Name | (1,4-dihydroxynaphthalen-2-yl)-phenylmethanone |
|---|---|
| PubChem CID | 11277063 |
| Molecular Formula | C17H12O3 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | (1,4-dihydroxynaphthalen-2-yl)-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1cc(O)c2ccccc2c1O |
| InChI | InChI=1S/C17H12O3/c18-15-10-14(16(19)11-6-2-1-3-7-11)17(20)13-9-5-4-8-12(13)15/h1-10,18,20H |
| InChIKey | QGOOAEUHQGFESJ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|