C19H21NO5 — CID 123805011
benzyl 4-(2,5-dihydroxy-4-methoxy-3-methylphenyl)iminobutanoate (PubChem CID 123805011) has the molecular formula C19H21NO5 and a molecular weight of 343.38 g/mol. Its IUPAC name is benzyl 4-(2,5-dihydroxy-4-methoxy-3-methylphenyl)iminobutanoate.
| Compound Name | benzyl 4-(2,5-dihydroxy-4-methoxy-3-methylphenyl)iminobutanoate |
|---|---|
| PubChem CID | 123805011 |
| Molecular Formula | C19H21NO5 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | benzyl 4-(2,5-dihydroxy-4-methoxy-3-methylphenyl)iminobutanoate |
| SMILES | COc1c(O)cc(/N=C/CCC(=O)OCc2ccccc2)c(O)c1C |
| InChI | InChI=1S/C19H21NO5/c1-13-18(23)15(11-16(21)19(13)24-2)20-10-6-9-17(22)25-12-14-7-4-3-5-8-14/h3-5,7-8,10-11,21,23H,6,9,12H2,1-2H3/b20-10+ |
| InChIKey | HAWCSVZTBMSGJB-KEBDBYFISA-N |
| XLogP | 3.64 |
| TPSA | 88.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|