C20H23NO6 — CID 135071512
benzyl N-[(2S)-1-(5-hydroxy-2,4-dimethoxy-3-methylphenyl)-3-oxopropan-2-yl]carbamate (PubChem CID 135071512) has the molecular formula C20H23NO6 and a molecular weight of 373.41 g/mol. Its IUPAC name is benzyl N-[(2S)-1-(5-hydroxy-2,4-dimethoxy-3-methylphenyl)-3-oxopropan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-(5-hydroxy-2,4-dimethoxy-3-methylphenyl)-3-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 135071512 |
| Molecular Formula | C20H23NO6 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | benzyl N-[(2S)-1-(5-hydroxy-2,4-dimethoxy-3-methylphenyl)-3-oxopropan-2-yl]carbamate |
| SMILES | COc1c(O)cc(C[C@@H](C=O)NC(=O)OCc2ccccc2)c(OC)c1C |
| InChI | InChI=1S/C20H23NO6/c1-13-18(25-2)15(10-17(23)19(13)26-3)9-16(11-22)21-20(24)27-12-14-7-5-4-6-8-14/h4-8,10-11,16,23H,9,12H2,1-3H3,(H,21,24)/t16-/m0/s1 |
| InChIKey | ROKKCSJHRSRTHR-INIZCTEOSA-N |
| XLogP | 2.75 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|