C27H29NO2 — CID 58416912
benzyl N-[(E,2R,5R)-5-methyl-1,6-diphenylhex-3-en-2-yl]carbamate (PubChem CID 58416912) has the molecular formula C27H29NO2 and a molecular weight of 399.53 g/mol. Its IUPAC name is benzyl N-[(E,2R,5R)-5-methyl-1,6-diphenylhex-3-en-2-yl]carbamate.
| Compound Name | benzyl N-[(E,2R,5R)-5-methyl-1,6-diphenylhex-3-en-2-yl]carbamate |
|---|---|
| PubChem CID | 58416912 |
| Molecular Formula | C27H29NO2 |
| Molecular Weight | 399.53 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | benzyl N-[(E,2R,5R)-5-methyl-1,6-diphenylhex-3-en-2-yl]carbamate |
| SMILES | C[C@@H](/C=C/[C@@H](Cc1ccccc1)NC(=O)OCc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C27H29NO2/c1-22(19-23-11-5-2-6-12-23)17-18-26(20-24-13-7-3-8-14-24)28-27(29)30-21-25-15-9-4-10-16-25/h2-18,22,26H,19-21H2,1H3,(H,28,29)/b18-17+/t22-,26-/m0/s1 |
| InChIKey | NVRVWFRASWWEKO-SRWHSLIMSA-N |
| XLogP | 5.96 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.53 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|