C21H23NO4 — CID 70048195
(Z,6S)-7-phenyl-6-(phenylmethoxycarbonylamino)hept-4-enoic acid (PubChem CID 70048195) has the molecular formula C21H23NO4 and a molecular weight of 353.42 g/mol. Its IUPAC name is (Z,6S)-7-phenyl-6-(phenylmethoxycarbonylamino)hept-4-enoic acid.
| Compound Name | (Z,6S)-7-phenyl-6-(phenylmethoxycarbonylamino)hept-4-enoic acid |
|---|---|
| PubChem CID | 70048195 |
| Molecular Formula | C21H23NO4 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | (Z,6S)-7-phenyl-6-(phenylmethoxycarbonylamino)hept-4-enoic acid |
| SMILES | O=C(O)CC/C=C\[C@H](Cc1ccccc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H23NO4/c23-20(24)14-8-7-13-19(15-17-9-3-1-4-10-17)22-21(25)26-16-18-11-5-2-6-12-18/h1-7,9-13,19H,8,14-16H2,(H,22,25)(H,23,24)/b13-7-/t19-/m1/s1 |
| InChIKey | OJFLOZCPFWFOBR-IVGFIOLJSA-N |
| XLogP | 3.95 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|