C25H31NO5 — CID 11048169
tert-butyl (E,2R,5S)-2-benzyl-6-hydroxy-5-(phenylmethoxycarbonylamino)hex-3-enoate (PubChem CID 11048169) has the molecular formula C25H31NO5 and a molecular weight of 425.53 g/mol. Its IUPAC name is tert-butyl (E,2R,5S)-2-benzyl-6-hydroxy-5-(phenylmethoxycarbonylamino)hex-3-enoate.
| Compound Name | tert-butyl (E,2R,5S)-2-benzyl-6-hydroxy-5-(phenylmethoxycarbonylamino)hex-3-enoate |
|---|---|
| PubChem CID | 11048169 |
| Molecular Formula | C25H31NO5 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | tert-butyl (E,2R,5S)-2-benzyl-6-hydroxy-5-(phenylmethoxycarbonylamino)hex-3-enoate |
| SMILES | CC(C)(C)OC(=O)[C@@H](/C=C/[C@@H](CO)NC(=O)OCc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C25H31NO5/c1-25(2,3)31-23(28)21(16-19-10-6-4-7-11-19)14-15-22(17-27)26-24(29)30-18-20-12-8-5-9-13-20/h4-15,21-22,27H,16-18H2,1-3H3,(H,26,29)/b15-14+/t21-,22-/m0/s1 |
| InChIKey | RRKDYARFVWVBPU-TYOAQRMGSA-N |
| XLogP | 4.03 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|