C25H25NO3 — CID 54196079
benzyl N-[(2S)-1-oxo-3-[2-(2-phenylethyl)phenyl]propan-2-yl]carbamate (PubChem CID 54196079) has the molecular formula C25H25NO3 and a molecular weight of 387.48 g/mol. Its IUPAC name is benzyl N-[(2S)-1-oxo-3-[2-(2-phenylethyl)phenyl]propan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-oxo-3-[2-(2-phenylethyl)phenyl]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 54196079 |
| Molecular Formula | C25H25NO3 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | benzyl N-[(2S)-1-oxo-3-[2-(2-phenylethyl)phenyl]propan-2-yl]carbamate |
| SMILES | O=C[C@H](Cc1ccccc1CCc1ccccc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C25H25NO3/c27-18-24(26-25(28)29-19-21-11-5-2-6-12-21)17-23-14-8-7-13-22(23)16-15-20-9-3-1-4-10-20/h1-14,18,24H,15-17,19H2,(H,26,28)/t24-/m0/s1 |
| InChIKey | PLWRULDQGICUBV-DEOSSOPVSA-N |
| XLogP | 4.51 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|