C36H39N3O5 — CID 23574370
benzyl N-[3-hydroxy-4-[[(2S)-1-oxo-3-phenylpropan-2-yl]carbamoyl-(2-phenylethyl)amino]-1-phenylbutan-2-yl]carbamate (PubChem CID 23574370) has the molecular formula C36H39N3O5 and a molecular weight of 593.72 g/mol. Its IUPAC name is benzyl N-[3-hydroxy-4-[[(2S)-1-oxo-3-phenylpropan-2-yl]carbamoyl-(2-phenylethyl)amino]-1-phenylbutan-2-yl]carbamate.
| Compound Name | benzyl N-[3-hydroxy-4-[[(2S)-1-oxo-3-phenylpropan-2-yl]carbamoyl-(2-phenylethyl)amino]-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 23574370 |
| Molecular Formula | C36H39N3O5 |
| Molecular Weight | 593.72 g/mol |
| Exact Mass | 593.29 |
| IUPAC Name | benzyl N-[3-hydroxy-4-[[(2S)-1-oxo-3-phenylpropan-2-yl]carbamoyl-(2-phenylethyl)amino]-1-phenylbutan-2-yl]carbamate |
| SMILES | O=C[C@H](Cc1ccccc1)NC(=O)N(CCc1ccccc1)CC(O)C(Cc1ccccc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C36H39N3O5/c40-26-32(23-29-15-7-2-8-16-29)37-35(42)39(22-21-28-13-5-1-6-14-28)25-34(41)33(24-30-17-9-3-10-18-30)38-36(43)44-27-31-19-11-4-12-20-31/h1-20,26,32-34,41H,21-25,27H2,(H,37,42)(H,38,43)/t32-,33?,34?/m0/s1 |
| InChIKey | NUCHDEMVSCCAQZ-BGVJURHFSA-N |
| XLogP | 4.95 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.72 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|