About benzyl pent-4-enoate;pent-4-enoic acid
benzyl pent-4-enoate;pent-4-enoic acid (PubChem CID 160968601) has the molecular formula C17H22O4
and a molecular weight of 290.36 g/mol. Its IUPAC name is benzyl pent-4-enoate;pent-4-enoic acid.
Molecular Properties
| Compound Name | benzyl pent-4-enoate;pent-4-enoic acid |
| PubChem CID | 160968601 |
| Molecular Formula | C17H22O4 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | benzyl pent-4-enoate;pent-4-enoic acid |
| SMILES | C=CCCC(=O)O.C=CCCC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C12H14O2.C5H8O2/c1-2-3-9-12(13)14-10-11-7-5-4-6-8-11;1-2-3-4-5(6)7/h2,4-8H,1,3,9-10H2;2H,1,3-4H2,(H,6,7) |
| InChIKey | SXYNQDIWYROPSH-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze benzyl pent-4-enoate;pent-4-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl pent-4-enoate;pent-4-enoic acid?
The IUPAC name of benzyl pent-4-enoate;pent-4-enoic acid (CID 160968601) is benzyl pent-4-enoate;pent-4-enoic acid.
What is the SMILES notation for benzyl pent-4-enoate;pent-4-enoic acid?
The canonical SMILES for benzyl pent-4-enoate;pent-4-enoic acid is C=CCCC(=O)O.C=CCCC(=O)OCc1ccccc1.
What is the InChIKey of benzyl pent-4-enoate;pent-4-enoic acid?
The InChIKey is SXYNQDIWYROPSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O2.C5H8O2/c1-2-3-9-12(13)14-10-11-7-5-4-6-8-11;1-2-3-4-5(6)7/h2,4-8H,1,3,9-10H2;2H,1,3-4H2,(H,6,7).
What are the key properties of benzyl pent-4-enoate;pent-4-enoic acid?
benzyl pent-4-enoate;pent-4-enoic acid has a molecular weight of 290.36 g/mol, XLogP of 3.73, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl pent-4-enoate;pent-4-enoic acid is sourced from PubChem (CID 160968601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).