C27H32Cl2O5 — CID 163467354
benzyl 3-(2,2-dichloro-3-oxocyclobutyl)propanoate;benzyl pent-4-enoate;methane (PubChem CID 163467354) has the molecular formula C27H32Cl2O5 and a molecular weight of 507.45 g/mol. Its IUPAC name is benzyl 3-(2,2-dichloro-3-oxocyclobutyl)propanoate;benzyl pent-4-enoate;methane.
| Compound Name | benzyl 3-(2,2-dichloro-3-oxocyclobutyl)propanoate;benzyl pent-4-enoate;methane |
|---|---|
| PubChem CID | 163467354 |
| Molecular Formula | C27H32Cl2O5 |
| Molecular Weight | 507.45 g/mol |
| Exact Mass | 506.16 |
| IUPAC Name | benzyl 3-(2,2-dichloro-3-oxocyclobutyl)propanoate;benzyl pent-4-enoate;methane |
| SMILES | C.C=CCCC(=O)OCc1ccccc1.O=C(CCC1CC(=O)C1(Cl)Cl)OCc1ccccc1 |
| InChI | InChI=1S/C14H14Cl2O3.C12H14O2.CH4/c15-14(16)11(8-12(14)17)6-7-13(18)19-9-10-4-2-1-3-5-10;1-2-3-9-12(13)14-10-11-7-5-4-6-8-11;/h1-5,11H,6-9H2;2,4-8H,1,3,9-10H2;1H4 |
| InChIKey | BTSRVYJFVFVRJU-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.45 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|