C18H22O4 — CID 135055086
methyl 3-[(1S,3R)-3-ethenyl-4-oxo-3-phenylmethoxycyclopentyl]propanoate (PubChem CID 135055086) has the molecular formula C18H22O4 and a molecular weight of 302.37 g/mol. Its IUPAC name is methyl 3-[(1S,3R)-3-ethenyl-4-oxo-3-phenylmethoxycyclopentyl]propanoate.
| Compound Name | methyl 3-[(1S,3R)-3-ethenyl-4-oxo-3-phenylmethoxycyclopentyl]propanoate |
|---|---|
| PubChem CID | 135055086 |
| Molecular Formula | C18H22O4 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | methyl 3-[(1S,3R)-3-ethenyl-4-oxo-3-phenylmethoxycyclopentyl]propanoate |
| SMILES | C=C[C@]1(OCc2ccccc2)C[C@H](CCC(=O)OC)CC1=O |
| InChI | InChI=1S/C18H22O4/c1-3-18(22-13-14-7-5-4-6-8-14)12-15(11-16(18)19)9-10-17(20)21-2/h3-8,15H,1,9-13H2,2H3/t15-,18+/m1/s1 |
| InChIKey | BYNZSIUPIIMLSF-QAPCUYQASA-N |
| XLogP | 3.06 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|