C19H26O4 — CID 135025497
methyl 2-[(1R,3R)-3-hydroxy-2,2-dimethyl-6-methylidene-4-phenylmethoxycyclohexyl]acetate (PubChem CID 135025497) has the molecular formula C19H26O4 and a molecular weight of 318.41 g/mol. Its IUPAC name is methyl 2-[(1R,3R)-3-hydroxy-2,2-dimethyl-6-methylidene-4-phenylmethoxycyclohexyl]acetate.
| Compound Name | methyl 2-[(1R,3R)-3-hydroxy-2,2-dimethyl-6-methylidene-4-phenylmethoxycyclohexyl]acetate |
|---|---|
| PubChem CID | 135025497 |
| Molecular Formula | C19H26O4 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | methyl 2-[(1R,3R)-3-hydroxy-2,2-dimethyl-6-methylidene-4-phenylmethoxycyclohexyl]acetate |
| SMILES | C=C1CC(OCc2ccccc2)[C@H](O)C(C)(C)[C@@H]1CC(=O)OC |
| InChI | InChI=1S/C19H26O4/c1-13-10-16(23-12-14-8-6-5-7-9-14)18(21)19(2,3)15(13)11-17(20)22-4/h5-9,15-16,18,21H,1,10-12H2,2-4H3/t15-,16?,18+/m1/s1 |
| InChIKey | RSVOOJBAINFIPW-AGPBCMBSSA-N |
| XLogP | 3.10 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|