C22H26O5S — CID 102214934
methyl 2-[(2S,3R,4S,5S)-5-hydroxy-3,4-bis(phenylmethoxy)thian-2-yl]acetate (PubChem CID 102214934) has the molecular formula C22H26O5S and a molecular weight of 402.51 g/mol. Its IUPAC name is methyl 2-[(2S,3R,4S,5S)-5-hydroxy-3,4-bis(phenylmethoxy)thian-2-yl]acetate.
| Compound Name | methyl 2-[(2S,3R,4S,5S)-5-hydroxy-3,4-bis(phenylmethoxy)thian-2-yl]acetate |
|---|---|
| PubChem CID | 102214934 |
| Molecular Formula | C22H26O5S |
| Molecular Weight | 402.51 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | methyl 2-[(2S,3R,4S,5S)-5-hydroxy-3,4-bis(phenylmethoxy)thian-2-yl]acetate |
| SMILES | COC(=O)C[C@@H]1SCC(O)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C22H26O5S/c1-25-20(24)12-19-22(27-14-17-10-6-3-7-11-17)21(18(23)15-28-19)26-13-16-8-4-2-5-9-16/h2-11,18-19,21-23H,12-15H2,1H3/t18?,19-,21-,22-/m0/s1 |
| InChIKey | MWDWNWASELBPHX-IXWRAZNESA-N |
| XLogP | 3.20 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.51 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |