C14H18O6 — CID 163625128
methyl (2R,3R,5R)-3,5-dihydroxy-4-phenylmethoxyoxane-2-carboxylate (PubChem CID 163625128) has the molecular formula C14H18O6 and a molecular weight of 282.29 g/mol. Its IUPAC name is methyl (2R,3R,5R)-3,5-dihydroxy-4-phenylmethoxyoxane-2-carboxylate.
| Compound Name | methyl (2R,3R,5R)-3,5-dihydroxy-4-phenylmethoxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 163625128 |
| Molecular Formula | C14H18O6 |
| Molecular Weight | 282.29 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | methyl (2R,3R,5R)-3,5-dihydroxy-4-phenylmethoxyoxane-2-carboxylate |
| SMILES | COC(=O)[C@@H]1OC[C@@H](O)C(OCc2ccccc2)[C@H]1O |
| InChI | InChI=1S/C14H18O6/c1-18-14(17)13-11(16)12(10(15)8-20-13)19-7-9-5-3-2-4-6-9/h2-6,10-13,15-16H,7-8H2,1H3/t10-,11-,12?,13-/m1/s1 |
| InChIKey | HRJGSJXINFROPB-ZHRBOBAGSA-N |
| XLogP | -0.13 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.29 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |