C29H32O6 — CID 59011060
benzyl (3R,4R)-5-hydroxy-4-phenylmethoxy-3-(3-phenylpropoxy)oxane-2-carboxylate (PubChem CID 59011060) has the molecular formula C29H32O6 and a molecular weight of 476.57 g/mol. Its IUPAC name is benzyl (3R,4R)-5-hydroxy-4-phenylmethoxy-3-(3-phenylpropoxy)oxane-2-carboxylate.
| Compound Name | benzyl (3R,4R)-5-hydroxy-4-phenylmethoxy-3-(3-phenylpropoxy)oxane-2-carboxylate |
|---|---|
| PubChem CID | 59011060 |
| Molecular Formula | C29H32O6 |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.22 |
| IUPAC Name | benzyl (3R,4R)-5-hydroxy-4-phenylmethoxy-3-(3-phenylpropoxy)oxane-2-carboxylate |
| SMILES | O=C(OCc1ccccc1)C1OCC(O)[C@@H](OCc2ccccc2)[C@H]1OCCCc1ccccc1 |
| InChI | InChI=1S/C29H32O6/c30-25-21-34-28(29(31)35-20-24-15-8-3-9-16-24)27(26(25)33-19-23-13-6-2-7-14-23)32-18-10-17-22-11-4-1-5-12-22/h1-9,11-16,25-28,30H,10,17-21H2/t25?,26-,27-,28?/m1/s1 |
| InChIKey | AIVRUNTTXZZFHQ-IEBRUALESA-N |
| XLogP | 4.09 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|