C14H20O3 — CID 122658990
(3R,4S,5R,6S)-5,6-dimethyl-4-phenylmethoxyoxan-3-ol (PubChem CID 122658990) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is (3R,4S,5R,6S)-5,6-dimethyl-4-phenylmethoxyoxan-3-ol.
| Compound Name | (3R,4S,5R,6S)-5,6-dimethyl-4-phenylmethoxyoxan-3-ol |
|---|---|
| PubChem CID | 122658990 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | (3R,4S,5R,6S)-5,6-dimethyl-4-phenylmethoxyoxan-3-ol |
| SMILES | C[C@H]1[C@H](OCc2ccccc2)[C@H](O)CO[C@H]1C |
| InChI | InChI=1S/C14H20O3/c1-10-11(2)16-9-13(15)14(10)17-8-12-6-4-3-5-7-12/h3-7,10-11,13-15H,8-9H2,1-2H3/t10-,11+,13-,14+/m1/s1 |
| InChIKey | WTZAOBZPVFBYSR-WVWOOGAGSA-N |
| XLogP | 1.99 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |