C22H28O5 — CID 58510392
(3S,4R,5S,6S,7S)-7-methoxy-4-methyl-5,6-bis(phenylmethoxy)oxepan-3-ol (PubChem CID 58510392) has the molecular formula C22H28O5 and a molecular weight of 372.46 g/mol. Its IUPAC name is (3S,4R,5S,6S,7S)-7-methoxy-4-methyl-5,6-bis(phenylmethoxy)oxepan-3-ol.
| Compound Name | (3S,4R,5S,6S,7S)-7-methoxy-4-methyl-5,6-bis(phenylmethoxy)oxepan-3-ol |
|---|---|
| PubChem CID | 58510392 |
| Molecular Formula | C22H28O5 |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | (3S,4R,5S,6S,7S)-7-methoxy-4-methyl-5,6-bis(phenylmethoxy)oxepan-3-ol |
| SMILES | CO[C@H]1OC[C@@H](O)[C@@H](C)[C@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C22H28O5/c1-16-19(23)15-27-22(24-2)21(26-14-18-11-7-4-8-12-18)20(16)25-13-17-9-5-3-6-10-17/h3-12,16,19-23H,13-15H2,1-2H3/t16-,19-,20+,21+,22+/m1/s1 |
| InChIKey | MWJSIUAMRFWTOR-PJYFRALDSA-N |
| XLogP | 3.16 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |