C23H28O6 — CID 14525549
(2S,3R,4S,5R,6S)-6-methoxy-2-[(2R,3S)-3-methyloxiran-2-yl]-4,5-bis(phenylmethoxy)oxan-3-ol (PubChem CID 14525549) has the molecular formula C23H28O6 and a molecular weight of 400.47 g/mol. Its IUPAC name is (2S,3R,4S,5R,6S)-6-methoxy-2-[(2R,3S)-3-methyloxiran-2-yl]-4,5-bis(phenylmethoxy)oxan-3-ol.
| Compound Name | (2S,3R,4S,5R,6S)-6-methoxy-2-[(2R,3S)-3-methyloxiran-2-yl]-4,5-bis(phenylmethoxy)oxan-3-ol |
|---|---|
| PubChem CID | 14525549 |
| Molecular Formula | C23H28O6 |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | (2S,3R,4S,5R,6S)-6-methoxy-2-[(2R,3S)-3-methyloxiran-2-yl]-4,5-bis(phenylmethoxy)oxan-3-ol |
| SMILES | CO[C@H]1O[C@H]([C@@H]2O[C@H]2C)[C@H](O)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C23H28O6/c1-15-19(28-15)21-18(24)20(26-13-16-9-5-3-6-10-16)22(23(25-2)29-21)27-14-17-11-7-4-8-12-17/h3-12,15,18-24H,13-14H2,1-2H3/t15-,18+,19+,20-,21-,22+,23-/m0/s1 |
| InChIKey | IMBRVGWMXNCFRE-KZLZDGEWSA-N |
| XLogP | 2.68 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|