C41H48O10 — CID 101238570
(2S,3R,4R,5S,6S)-2-[[(2R,3R,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy]-6-methyl-4-phenylmethoxyoxane-3,5-diol (PubChem CID 101238570) has the molecular formula C41H48O10 and a molecular weight of 700.83 g/mol. Its IUPAC name is (2S,3R,4R,5S,6S)-2-[[(2R,3R,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy]-6-methyl-4-phenylmethoxyoxane-3,5-diol.
| Compound Name | (2S,3R,4R,5S,6S)-2-[[(2R,3R,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy]-6-methyl-4-phenylmethoxyoxane-3,5-diol |
|---|---|
| PubChem CID | 101238570 |
| Molecular Formula | C41H48O10 |
| Molecular Weight | 700.83 g/mol |
| Exact Mass | 700.32 |
| IUPAC Name | (2S,3R,4R,5S,6S)-2-[[(2R,3R,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy]-6-methyl-4-phenylmethoxyoxane-3,5-diol |
| SMILES | CO[C@H]1O[C@H](CO[C@H]2O[C@@H](C)[C@H](O)[C@@H](OCc3ccccc3)[C@H]2O)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C41H48O10/c1-28-34(42)37(46-24-30-17-9-4-10-18-30)35(43)40(50-28)49-27-33-36(45-23-29-15-7-3-8-16-29)38(47-25-31-19-11-5-12-20-31)39(41(44-2)51-33)48-26-32-21-13-6-14-22-32/h3-22,28,33-43H,23-27H2,1-2H3/t28-,33+,34-,35+,36+,37+,38-,39+,40-,41-/m0/s1 |
| InChIKey | PGRQQPYIEDJUBC-HKPVSNPTSA-N |
| XLogP | 5.18 |
| TPSA | 114.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.83 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |