C41H48O10 — CID 14058132
(2R,3R,4R,5R,6R)-2-methoxy-6-methyl-5-[(2R,3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyoxane-3,4-diol (PubChem CID 14058132) has the molecular formula C41H48O10 and a molecular weight of 700.83 g/mol. Its IUPAC name is (2R,3R,4R,5R,6R)-2-methoxy-6-methyl-5-[(2R,3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyoxane-3,4-diol.
| Compound Name | (2R,3R,4R,5R,6R)-2-methoxy-6-methyl-5-[(2R,3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyoxane-3,4-diol |
|---|---|
| PubChem CID | 14058132 |
| Molecular Formula | C41H48O10 |
| Molecular Weight | 700.83 g/mol |
| Exact Mass | 700.32 |
| IUPAC Name | (2R,3R,4R,5R,6R)-2-methoxy-6-methyl-5-[(2R,3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyoxane-3,4-diol |
| SMILES | CO[C@@H]1O[C@H](C)[C@H](O[C@H]2O[C@H](COCc3ccccc3)[C@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]2OCc2ccccc2)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C41H48O10/c1-28-36(34(42)35(43)40(44-2)49-28)51-41-39(48-26-32-21-13-6-14-22-32)38(47-25-31-19-11-5-12-20-31)37(46-24-30-17-9-4-10-18-30)33(50-41)27-45-23-29-15-7-3-8-16-29/h3-22,28,33-43H,23-27H2,1-2H3/t28-,33-,34-,35-,36+,37+,38+,39-,40-,41-/m1/s1 |
| InChIKey | DKFILHOMIPMYMO-ZHKQVZGYSA-N |
| XLogP | 5.18 |
| TPSA | 114.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.83 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |