C48H54O9 — CID 59491334
(2S,3R,5S)-2,6-dimethyl-5-phenylmethoxy-4-[(2S,4S,5S)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyoxan-3-ol (PubChem CID 59491334) has the molecular formula C48H54O9 and a molecular weight of 774.95 g/mol. Its IUPAC name is (2S,3R,5S)-2,6-dimethyl-5-phenylmethoxy-4-[(2S,4S,5S)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyoxan-3-ol.
| Compound Name | (2S,3R,5S)-2,6-dimethyl-5-phenylmethoxy-4-[(2S,4S,5S)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyoxan-3-ol |
|---|---|
| PubChem CID | 59491334 |
| Molecular Formula | C48H54O9 |
| Molecular Weight | 774.95 g/mol |
| Exact Mass | 774.38 |
| IUPAC Name | (2S,3R,5S)-2,6-dimethyl-5-phenylmethoxy-4-[(2S,4S,5S)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyoxan-3-ol |
| SMILES | CC1O[C@@H](C)[C@@H](O)C(O[C@@H]2OC(COCc3ccccc3)[C@H](OCc3ccccc3)[C@H](OCc3ccccc3)C2OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C48H54O9/c1-34-42(49)45(43(35(2)55-34)51-29-37-20-10-4-11-21-37)57-48-47(54-32-40-26-16-7-17-27-40)46(53-31-39-24-14-6-15-25-39)44(52-30-38-22-12-5-13-23-38)41(56-48)33-50-28-36-18-8-3-9-19-36/h3-27,34-35,41-49H,28-33H2,1-2H3/t34-,35?,41?,42+,43-,44-,45?,46-,47?,48-/m0/s1 |
| InChIKey | PVHIEAYDJBRTEU-VGAPOGNLSA-N |
| XLogP | 7.82 |
| TPSA | 94.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.95 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |