C46H50O9 — CID 11787527
(3R,4R,5S,6S)-4-[(2S,3R,4R,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]oxy-6-methyl-3,5-bis(phenylmethoxy)oxan-2-ol (PubChem CID 11787527) has the molecular formula C46H50O9 and a molecular weight of 746.90 g/mol. Its IUPAC name is (3R,4R,5S,6S)-4-[(2S,3R,4R,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]oxy-6-methyl-3,5-bis(phenylmethoxy)oxan-2-ol.
| Compound Name | (3R,4R,5S,6S)-4-[(2S,3R,4R,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]oxy-6-methyl-3,5-bis(phenylmethoxy)oxan-2-ol |
|---|---|
| PubChem CID | 11787527 |
| Molecular Formula | C46H50O9 |
| Molecular Weight | 746.90 g/mol |
| Exact Mass | 746.35 |
| IUPAC Name | (3R,4R,5S,6S)-4-[(2S,3R,4R,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]oxy-6-methyl-3,5-bis(phenylmethoxy)oxan-2-ol |
| SMILES | C[C@@H]1OC(O)[C@H](OCc2ccccc2)[C@H](O[C@@H]2O[C@H](COCc3ccccc3)[C@@H](OCc3ccccc3)[C@H]2OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C46H50O9/c1-33-40(49-28-35-19-9-3-10-20-35)42(43(45(47)53-33)51-30-37-23-13-5-14-24-37)55-46-44(52-31-38-25-15-6-16-26-38)41(50-29-36-21-11-4-12-22-36)39(54-46)32-48-27-34-17-7-2-8-18-34/h2-26,33,39-47H,27-32H2,1H3/t33-,39+,40-,41+,42+,43+,44+,45?,46-/m0/s1 |
| InChIKey | FDVSUNBWDDRURL-OFUZYDEASA-N |
| XLogP | 7.39 |
| TPSA | 94.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.90 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |