C55H60O10 — CID 10533690
(1R,2R,3S,4S,5S)-5-[[(2R,3R,4S,5R,6R)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy]-2,3,4-tris(phenylmethoxy)cyclohexan-1-ol (PubChem CID 10533690) has the molecular formula C55H60O10 and a molecular weight of 881.08 g/mol. Its IUPAC name is (1R,2R,3S,4S,5S)-5-[[(2R,3R,4S,5R,6R)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy]-2,3,4-tris(phenylmethoxy)cyclohexan-1-ol.
| Compound Name | (1R,2R,3S,4S,5S)-5-[[(2R,3R,4S,5R,6R)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy]-2,3,4-tris(phenylmethoxy)cyclohexan-1-ol |
|---|---|
| PubChem CID | 10533690 |
| Molecular Formula | C55H60O10 |
| Molecular Weight | 881.08 g/mol |
| Exact Mass | 880.42 |
| IUPAC Name | (1R,2R,3S,4S,5S)-5-[[(2R,3R,4S,5R,6R)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy]-2,3,4-tris(phenylmethoxy)cyclohexan-1-ol |
| SMILES | CO[C@@H]1O[C@H](CO[C@H]2C[C@@H](O)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]2OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C55H60O10/c1-57-55-54(64-38-45-30-18-7-19-31-45)53(63-37-44-28-16-6-17-29-44)51(61-35-42-24-12-4-13-25-42)48(65-55)39-58-47-32-46(56)49(59-33-40-20-8-2-9-21-40)52(62-36-43-26-14-5-15-27-43)50(47)60-34-41-22-10-3-11-23-41/h2-31,46-56H,32-39H2,1H3/t46-,47+,48-,49-,50+,51-,52+,53+,54-,55-/m1/s1 |
| InChIKey | NNWSEWHXCQOWFN-MQXINTBUSA-N |
| XLogP | 9.02 |
| TPSA | 103.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 881.08 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |