C29H33ClO6 — CID 54470697
(2R,3R,4S,5R,6S)-2-(chloromethoxymethyl)-6-methoxy-3,4,5-tris(phenylmethoxy)oxane (PubChem CID 54470697) has the molecular formula C29H33ClO6 and a molecular weight of 513.03 g/mol. Its IUPAC name is (2R,3R,4S,5R,6S)-2-(chloromethoxymethyl)-6-methoxy-3,4,5-tris(phenylmethoxy)oxane.
| Compound Name | (2R,3R,4S,5R,6S)-2-(chloromethoxymethyl)-6-methoxy-3,4,5-tris(phenylmethoxy)oxane |
|---|---|
| PubChem CID | 54470697 |
| Molecular Formula | C29H33ClO6 |
| Molecular Weight | 513.03 g/mol |
| Exact Mass | 512.20 |
| IUPAC Name | (2R,3R,4S,5R,6S)-2-(chloromethoxymethyl)-6-methoxy-3,4,5-tris(phenylmethoxy)oxane |
| SMILES | CO[C@H]1O[C@H](COCCl)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C29H33ClO6/c1-31-29-28(35-19-24-15-9-4-10-16-24)27(34-18-23-13-7-3-8-14-23)26(25(36-29)20-32-21-30)33-17-22-11-5-2-6-12-22/h2-16,25-29H,17-21H2,1H3/t25-,26-,27+,28-,29+/m1/s1 |
| InChIKey | XIDIYVMXKCJTJN-RQKPWJHBSA-N |
| XLogP | 5.33 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.03 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|