C37H46O9 — CID 11498271
(2S,3S,4R,5R,6R)-2-[(2S,3S,4S,5R,6R)-2-methoxy-6-methyl-3,5-bis(phenylmethoxy)oxan-4-yl]oxy-6-methyl-5-phenylmethoxy-4-prop-2-enoxyoxan-3-ol (PubChem CID 11498271) has the molecular formula C37H46O9 and a molecular weight of 634.77 g/mol. Its IUPAC name is (2S,3S,4R,5R,6R)-2-[(2S,3S,4S,5R,6R)-2-methoxy-6-methyl-3,5-bis(phenylmethoxy)oxan-4-yl]oxy-6-methyl-5-phenylmethoxy-4-prop-2-enoxyoxan-3-ol.
| Compound Name | (2S,3S,4R,5R,6R)-2-[(2S,3S,4S,5R,6R)-2-methoxy-6-methyl-3,5-bis(phenylmethoxy)oxan-4-yl]oxy-6-methyl-5-phenylmethoxy-4-prop-2-enoxyoxan-3-ol |
|---|---|
| PubChem CID | 11498271 |
| Molecular Formula | C37H46O9 |
| Molecular Weight | 634.77 g/mol |
| Exact Mass | 634.31 |
| IUPAC Name | (2S,3S,4R,5R,6R)-2-[(2S,3S,4S,5R,6R)-2-methoxy-6-methyl-3,5-bis(phenylmethoxy)oxan-4-yl]oxy-6-methyl-5-phenylmethoxy-4-prop-2-enoxyoxan-3-ol |
| SMILES | C=CCO[C@@H]1[C@H](O)[C@H](O[C@@H]2[C@H](OCc3ccccc3)[C@@H](OC)O[C@H](C)[C@H]2OCc2ccccc2)O[C@H](C)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C37H46O9/c1-5-21-40-33-30(38)36(44-25(2)31(33)41-22-27-15-9-6-10-16-27)46-34-32(42-23-28-17-11-7-12-18-28)26(3)45-37(39-4)35(34)43-24-29-19-13-8-14-20-29/h5-20,25-26,30-38H,1,21-24H2,2-4H3/t25-,26-,30+,31-,32-,33-,34+,35+,36+,37+/m1/s1 |
| InChIKey | RZIVAFRLRKWUFK-WHKYLEMSSA-N |
| XLogP | 5.20 |
| TPSA | 94.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.77 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|