C50H56O9 — CID 11377812
(2R,3S,4S,5R,6R)-2-methyl-3-[(2R,3R,4S,5S,6R)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxy-4,5-bis(phenylmethoxy)-6-prop-2-enoxyoxane (PubChem CID 11377812) has the molecular formula C50H56O9 and a molecular weight of 800.99 g/mol. Its IUPAC name is (2R,3S,4S,5R,6R)-2-methyl-3-[(2R,3R,4S,5S,6R)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxy-4,5-bis(phenylmethoxy)-6-prop-2-enoxyoxane.
| Compound Name | (2R,3S,4S,5R,6R)-2-methyl-3-[(2R,3R,4S,5S,6R)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxy-4,5-bis(phenylmethoxy)-6-prop-2-enoxyoxane |
|---|---|
| PubChem CID | 11377812 |
| Molecular Formula | C50H56O9 |
| Molecular Weight | 800.99 g/mol |
| Exact Mass | 800.39 |
| IUPAC Name | (2R,3S,4S,5R,6R)-2-methyl-3-[(2R,3R,4S,5S,6R)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxy-4,5-bis(phenylmethoxy)-6-prop-2-enoxyoxane |
| SMILES | C=CCO[C@@H]1O[C@H](C)[C@H](O[C@H]2O[C@H](C)[C@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]2OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C50H56O9/c1-4-30-51-49-47(55-34-41-26-16-8-17-27-41)46(54-33-40-24-14-7-15-25-40)44(37(3)57-49)59-50-48(56-35-42-28-18-9-19-29-42)45(53-32-39-22-12-6-13-23-39)43(36(2)58-50)52-31-38-20-10-5-11-21-38/h4-29,36-37,43-50H,1,30-35H2,2-3H3/t36-,37-,43+,44+,45+,46+,47-,48-,49-,50-/m1/s1 |
| InChIKey | KGARNWHWRAQRDF-PZVWBSNXSA-N |
| XLogP | 8.99 |
| TPSA | 83.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.99 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|