C19H26O5 — CID 101091396
(3aR,4S,7S,7aR)-2,2,4-trimethyl-7-phenylmethoxy-6-prop-2-enoxy-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran (PubChem CID 101091396) has the molecular formula C19H26O5 and a molecular weight of 334.41 g/mol. Its IUPAC name is (3aR,4S,7S,7aR)-2,2,4-trimethyl-7-phenylmethoxy-6-prop-2-enoxy-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran.
| Compound Name | (3aR,4S,7S,7aR)-2,2,4-trimethyl-7-phenylmethoxy-6-prop-2-enoxy-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran |
|---|---|
| PubChem CID | 101091396 |
| Molecular Formula | C19H26O5 |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | (3aR,4S,7S,7aR)-2,2,4-trimethyl-7-phenylmethoxy-6-prop-2-enoxy-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran |
| SMILES | C=CCOC1O[C@@H](C)[C@H]2OC(C)(C)O[C@H]2[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C19H26O5/c1-5-11-20-18-17(21-12-14-9-7-6-8-10-14)16-15(13(2)22-18)23-19(3,4)24-16/h5-10,13,15-18H,1,11-12H2,2-4H3/t13-,15+,16+,17-,18?/m0/s1 |
| InChIKey | IAYMHWSCFZSEQW-GOLFPGRKSA-N |
| XLogP | 3.04 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|