C18H20Cl3NO4 — CID 102348534
(3aR,4R,6S,7R,7aS)-4-methyl-7-phenylmethoxy-6-prop-2-enoxy-2-(trichloromethyl)-4,6,7,7a-tetrahydro-3aH-pyrano[4,3-d][1,3]oxazole (PubChem CID 102348534) has the molecular formula C18H20Cl3NO4 and a molecular weight of 420.72 g/mol. Its IUPAC name is (3aR,4R,6S,7R,7aS)-4-methyl-7-phenylmethoxy-6-prop-2-enoxy-2-(trichloromethyl)-4,6,7,7a-tetrahydro-3aH-pyrano[4,3-d][1,3]oxazole.
| Compound Name | (3aR,4R,6S,7R,7aS)-4-methyl-7-phenylmethoxy-6-prop-2-enoxy-2-(trichloromethyl)-4,6,7,7a-tetrahydro-3aH-pyrano[4,3-d][1,3]oxazole |
|---|---|
| PubChem CID | 102348534 |
| Molecular Formula | C18H20Cl3NO4 |
| Molecular Weight | 420.72 g/mol |
| Exact Mass | 419.05 |
| IUPAC Name | (3aR,4R,6S,7R,7aS)-4-methyl-7-phenylmethoxy-6-prop-2-enoxy-2-(trichloromethyl)-4,6,7,7a-tetrahydro-3aH-pyrano[4,3-d][1,3]oxazole |
| SMILES | C=CCO[C@H]1O[C@H](C)[C@@H]2OC(C(Cl)(Cl)Cl)=N[C@@H]2[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C18H20Cl3NO4/c1-3-9-23-16-15(24-10-12-7-5-4-6-8-12)13-14(11(2)25-16)26-17(22-13)18(19,20)21/h3-8,11,13-16H,1,9-10H2,2H3/t11-,13+,14+,15-,16+/m1/s1 |
| InChIKey | XHVHGQNBQGGSIM-CHUNWDLHSA-N |
| XLogP | 4.06 |
| TPSA | 49.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.72 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|