C29H40O7Si — CID 14541676
[(2R,3R,4R,5S,6S)-6-methyl-5-phenylmethoxy-2-prop-2-enoxy-4-(2-trimethylsilylethoxymethoxy)oxan-3-yl] benzoate (PubChem CID 14541676) has the molecular formula C29H40O7Si and a molecular weight of 528.72 g/mol. Its IUPAC name is [(2R,3R,4R,5S,6S)-6-methyl-5-phenylmethoxy-2-prop-2-enoxy-4-(2-trimethylsilylethoxymethoxy)oxan-3-yl] benzoate.
| Compound Name | [(2R,3R,4R,5S,6S)-6-methyl-5-phenylmethoxy-2-prop-2-enoxy-4-(2-trimethylsilylethoxymethoxy)oxan-3-yl] benzoate |
|---|---|
| PubChem CID | 14541676 |
| Molecular Formula | C29H40O7Si |
| Molecular Weight | 528.72 g/mol |
| Exact Mass | 528.25 |
| IUPAC Name | [(2R,3R,4R,5S,6S)-6-methyl-5-phenylmethoxy-2-prop-2-enoxy-4-(2-trimethylsilylethoxymethoxy)oxan-3-yl] benzoate |
| SMILES | C=CCO[C@@H]1O[C@@H](C)[C@H](OCc2ccccc2)[C@@H](OCOCC[Si](C)(C)C)[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C29H40O7Si/c1-6-17-32-29-27(36-28(30)24-15-11-8-12-16-24)26(34-21-31-18-19-37(3,4)5)25(22(2)35-29)33-20-23-13-9-7-10-14-23/h6-16,22,25-27,29H,1,17-21H2,2-5H3/t22-,25-,26+,27+,29+/m0/s1 |
| InChIKey | GRUZFEOJZNHTPR-VWKFQRONSA-N |
| XLogP | 5.44 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.72 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|