C23H26O6 — CID 11280965
[(2S,3S,4S,5R,6R)-5-hydroxy-2-methyl-6-phenylmethoxy-4-prop-2-enoxyoxan-3-yl] benzoate (PubChem CID 11280965) has the molecular formula C23H26O6 and a molecular weight of 398.46 g/mol. Its IUPAC name is [(2S,3S,4S,5R,6R)-5-hydroxy-2-methyl-6-phenylmethoxy-4-prop-2-enoxyoxan-3-yl] benzoate.
| Compound Name | [(2S,3S,4S,5R,6R)-5-hydroxy-2-methyl-6-phenylmethoxy-4-prop-2-enoxyoxan-3-yl] benzoate |
|---|---|
| PubChem CID | 11280965 |
| Molecular Formula | C23H26O6 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | [(2S,3S,4S,5R,6R)-5-hydroxy-2-methyl-6-phenylmethoxy-4-prop-2-enoxyoxan-3-yl] benzoate |
| SMILES | C=CCO[C@H]1[C@@H](O)[C@H](OCc2ccccc2)O[C@@H](C)[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C23H26O6/c1-3-14-26-21-19(24)23(27-15-17-10-6-4-7-11-17)28-16(2)20(21)29-22(25)18-12-8-5-9-13-18/h3-13,16,19-21,23-24H,1,14-15H2,2H3/t16-,19+,20-,21-,23+/m0/s1 |
| InChIKey | COGREBSZKQMFLL-DYTUJVSPSA-N |
| XLogP | 3.11 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|