C38H46O9 — CID 101430561
(3aR,4R,6S,7S,7aR)-2,2,6-trimethyl-4-prop-2-enoxy-7-[(3R,4S,5R)-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxy-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran (PubChem CID 101430561) has the molecular formula C38H46O9 and a molecular weight of 646.78 g/mol. Its IUPAC name is (3aR,4R,6S,7S,7aR)-2,2,6-trimethyl-4-prop-2-enoxy-7-[(3R,4S,5R)-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxy-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran.
| Compound Name | (3aR,4R,6S,7S,7aR)-2,2,6-trimethyl-4-prop-2-enoxy-7-[(3R,4S,5R)-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxy-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran |
|---|---|
| PubChem CID | 101430561 |
| Molecular Formula | C38H46O9 |
| Molecular Weight | 646.78 g/mol |
| Exact Mass | 646.31 |
| IUPAC Name | (3aR,4R,6S,7S,7aR)-2,2,6-trimethyl-4-prop-2-enoxy-7-[(3R,4S,5R)-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxy-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran |
| SMILES | C=CCO[C@@H]1O[C@@H](C)[C@H](OC2OC[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]2OCc2ccccc2)[C@H]2OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C38H46O9/c1-5-21-39-37-35-33(46-38(3,4)47-35)31(26(2)44-37)45-36-34(42-24-29-19-13-8-14-20-29)32(41-23-28-17-11-7-12-18-28)30(25-43-36)40-22-27-15-9-6-10-16-27/h5-20,26,30-37H,1,21-25H2,2-4H3/t26-,30+,31-,32-,33+,34+,35+,36?,37+/m0/s1 |
| InChIKey | AGQOQXTZRVFKNK-YBMFPPAUSA-N |
| XLogP | 5.95 |
| TPSA | 83.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.78 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|