C18H24O5S2 — CID 10810085
O-[(3aR,4S,7S,7aR)-2,2,4-trimethyl-6-phenylmethoxy-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl] methylsulfanylmethanethioate (PubChem CID 10810085) has the molecular formula C18H24O5S2 and a molecular weight of 384.52 g/mol. Its IUPAC name is O-[(3aR,4S,7S,7aR)-2,2,4-trimethyl-6-phenylmethoxy-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl] methylsulfanylmethanethioate.
| Compound Name | O-[(3aR,4S,7S,7aR)-2,2,4-trimethyl-6-phenylmethoxy-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl] methylsulfanylmethanethioate |
|---|---|
| PubChem CID | 10810085 |
| Molecular Formula | C18H24O5S2 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | O-[(3aR,4S,7S,7aR)-2,2,4-trimethyl-6-phenylmethoxy-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl] methylsulfanylmethanethioate |
| SMILES | CSC(=S)O[C@@H]1C(OCc2ccccc2)O[C@@H](C)[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C18H24O5S2/c1-11-13-14(23-18(2,3)22-13)15(21-17(24)25-4)16(20-11)19-10-12-8-6-5-7-9-12/h5-9,11,13-16H,10H2,1-4H3/t11-,13+,14+,15-,16?/m0/s1 |
| InChIKey | XUAMNEPHELSBGK-WMAUOLHGSA-N |
| XLogP | 3.50 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|