C18H26O4S2 — CID 11406076
O-[(4S,6R)-2,2,4,6-tetramethyl-4-(phenylmethoxymethyl)-1,3-dioxan-5-yl] methylsulfanylmethanethioate (PubChem CID 11406076) has the molecular formula C18H26O4S2 and a molecular weight of 370.54 g/mol. Its IUPAC name is O-[(4S,6R)-2,2,4,6-tetramethyl-4-(phenylmethoxymethyl)-1,3-dioxan-5-yl] methylsulfanylmethanethioate.
| Compound Name | O-[(4S,6R)-2,2,4,6-tetramethyl-4-(phenylmethoxymethyl)-1,3-dioxan-5-yl] methylsulfanylmethanethioate |
|---|---|
| PubChem CID | 11406076 |
| Molecular Formula | C18H26O4S2 |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | O-[(4S,6R)-2,2,4,6-tetramethyl-4-(phenylmethoxymethyl)-1,3-dioxan-5-yl] methylsulfanylmethanethioate |
| SMILES | CSC(=S)OC1[C@@H](C)OC(C)(C)O[C@@]1(C)COCc1ccccc1 |
| InChI | InChI=1S/C18H26O4S2/c1-13-15(20-16(23)24-5)18(4,22-17(2,3)21-13)12-19-11-14-9-7-6-8-10-14/h6-10,13,15H,11-12H2,1-5H3/t13-,15?,18+/m1/s1 |
| InChIKey | INXHKARBBALBCH-CLIJRUEWSA-N |
| XLogP | 4.17 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|