C23H26O6 — CID 11269526
(3aS,5R,6R,6aS)-2,2-dimethyl-6-phenylmethoxy-3a-(phenylmethoxymethyl)-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxole-5-carbaldehyde (PubChem CID 11269526) has the molecular formula C23H26O6 and a molecular weight of 398.46 g/mol. Its IUPAC name is (3aS,5R,6R,6aS)-2,2-dimethyl-6-phenylmethoxy-3a-(phenylmethoxymethyl)-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxole-5-carbaldehyde.
| Compound Name | (3aS,5R,6R,6aS)-2,2-dimethyl-6-phenylmethoxy-3a-(phenylmethoxymethyl)-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxole-5-carbaldehyde |
|---|---|
| PubChem CID | 11269526 |
| Molecular Formula | C23H26O6 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | (3aS,5R,6R,6aS)-2,2-dimethyl-6-phenylmethoxy-3a-(phenylmethoxymethyl)-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxole-5-carbaldehyde |
| SMILES | CC1(C)O[C@H]2[C@H](OCc3ccccc3)[C@H](C=O)O[C@@]2(COCc2ccccc2)O1 |
| InChI | InChI=1S/C23H26O6/c1-22(2)28-21-20(26-15-18-11-7-4-8-12-18)19(13-24)27-23(21,29-22)16-25-14-17-9-5-3-6-10-17/h3-13,19-21H,14-16H2,1-2H3/t19-,20+,21-,23-/m0/s1 |
| InChIKey | QAGXBYLNOFBBRK-KGSLCBSSSA-N |
| XLogP | 3.23 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|