C27H30O5 — CID 140986765
(2R,3R,4S,5R)-5-methyl-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-ol (PubChem CID 140986765) has the molecular formula C27H30O5 and a molecular weight of 434.53 g/mol. Its IUPAC name is (2R,3R,4S,5R)-5-methyl-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-ol.
| Compound Name | (2R,3R,4S,5R)-5-methyl-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-ol |
|---|---|
| PubChem CID | 140986765 |
| Molecular Formula | C27H30O5 |
| Molecular Weight | 434.53 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | (2R,3R,4S,5R)-5-methyl-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-ol |
| SMILES | C[C@]1(COCc2ccccc2)O[C@@H](O)[C@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C27H30O5/c1-27(20-29-17-21-11-5-2-6-12-21)25(31-19-23-15-9-4-10-16-23)24(26(28)32-27)30-18-22-13-7-3-8-14-22/h2-16,24-26,28H,17-20H2,1H3/t24-,25+,26-,27-/m1/s1 |
| InChIKey | IHVDXAJGJGUDFX-HVWQDESWSA-N |
| XLogP | 4.48 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.53 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |