C44H48O9 — CID 59226849
(3R,4S,5S)-6,6-bis[(4-methoxyphenyl)methoxymethyl]-3,4,5-tris(phenylmethoxy)oxan-2-ol (PubChem CID 59226849) has the molecular formula C44H48O9 and a molecular weight of 720.86 g/mol. Its IUPAC name is (3R,4S,5S)-6,6-bis[(4-methoxyphenyl)methoxymethyl]-3,4,5-tris(phenylmethoxy)oxan-2-ol.
| Compound Name | (3R,4S,5S)-6,6-bis[(4-methoxyphenyl)methoxymethyl]-3,4,5-tris(phenylmethoxy)oxan-2-ol |
|---|---|
| PubChem CID | 59226849 |
| Molecular Formula | C44H48O9 |
| Molecular Weight | 720.86 g/mol |
| Exact Mass | 720.33 |
| IUPAC Name | (3R,4S,5S)-6,6-bis[(4-methoxyphenyl)methoxymethyl]-3,4,5-tris(phenylmethoxy)oxan-2-ol |
| SMILES | COc1ccc(COCC2(COCc3ccc(OC)cc3)OC(O)[C@H](OCc3ccccc3)[C@@H](OCc3ccccc3)[C@@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C44H48O9/c1-46-38-22-18-36(19-23-38)26-48-31-44(32-49-27-37-20-24-39(47-2)25-21-37)42(52-30-35-16-10-5-11-17-35)40(50-28-33-12-6-3-7-13-33)41(43(45)53-44)51-29-34-14-8-4-9-15-34/h3-25,40-43,45H,26-32H2,1-2H3/t40-,41-,42+,43?/m1/s1 |
| InChIKey | MLPYRDHAUBAUCB-SQTXMFHSSA-N |
| XLogP | 7.28 |
| TPSA | 94.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.86 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |