C28H32O5 — CID 90854427
(1R,3S,4R)-2-[(4-methoxyphenyl)methoxy]-3,4-bis(phenylmethoxy)cyclohexan-1-ol (PubChem CID 90854427) has the molecular formula C28H32O5 and a molecular weight of 448.56 g/mol. Its IUPAC name is (1R,3S,4R)-2-[(4-methoxyphenyl)methoxy]-3,4-bis(phenylmethoxy)cyclohexan-1-ol.
| Compound Name | (1R,3S,4R)-2-[(4-methoxyphenyl)methoxy]-3,4-bis(phenylmethoxy)cyclohexan-1-ol |
|---|---|
| PubChem CID | 90854427 |
| Molecular Formula | C28H32O5 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | (1R,3S,4R)-2-[(4-methoxyphenyl)methoxy]-3,4-bis(phenylmethoxy)cyclohexan-1-ol |
| SMILES | COc1ccc(COC2[C@H](O)CC[C@@H](OCc3ccccc3)[C@@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C28H32O5/c1-30-24-14-12-23(13-15-24)20-32-27-25(29)16-17-26(31-18-21-8-4-2-5-9-21)28(27)33-19-22-10-6-3-7-11-22/h2-15,25-29H,16-20H2,1H3/t25-,26-,27?,28+/m1/s1 |
| InChIKey | ZHMJFYUIOHXYQX-YBOHRUJTSA-N |
| XLogP | 4.91 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |